CAS 1157719-91-9 appears in our catalog under these names: 5-(4-Bromo-2-chlorophenyl)-1,3,4-oxadiazol-2-amine, 95%, 5-(4-Bromo-2-chlorophenyl)-1,3,4-oxadiazol-2-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
5-(4-bromo-2-chlorophenyl)-1,3,4-oxadiazol-2-amine (CAS 1157719-91-9) is a chemical compound with the molecular formula C8H5BrClN3O and a molecular weight of 274.50 g/mol. IUPAC name: 5-(4-bromo-2-chlorophenyl)-1,3,4-oxadiazol-2-amine. InChIKey: XTEOJKTVXAELNO-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClN3O |
|---|---|
| Molecular weight | 274.50 g/mol |
| IUPAC name | 5-(4-bromo-2-chlorophenyl)-1,3,4-oxadiazol-2-amine |
| InChIKey | XTEOJKTVXAELNO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)Cl)C2=NN=C(O2)N |
Computed by PubChem (NCBI)