CAS 2793406-10-5 is the registry number for 6-Bromo-7-chloro-2-methylpyrido[2,3-d]pyrimidin-4(3H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-7-chloro-2-methyl-3H-pyrido[2,3-d]pyrimidin-4-one (CAS 2793406-10-5) is a chemical compound with the molecular formula C8H5BrClN3O and a molecular weight of 274.50 g/mol. IUPAC name: 6-bromo-7-chloro-2-methyl-3H-pyrido[2,3-d]pyrimidin-4-one. InChIKey: GEBNAQNNXDZFLW-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClN3O |
|---|---|
| Molecular weight | 274.50 g/mol |
| IUPAC name | 6-bromo-7-chloro-2-methyl-3H-pyrido[2,3-d]pyrimidin-4-one |
| InChIKey | GEBNAQNNXDZFLW-UHFFFAOYSA-N |
| SMILES | CC1=NC2=NC(=C(C=C2C(=O)N1)Br)Cl |
Computed by PubChem (NCBI)