CAS 2738394-22-2 is the registry number for 8-Bromo-6-chloro-2-methylpyrido[3,4-d]pyrimidin-4(1H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-bromo-6-chloro-2-methyl-3H-pyrido[3,4-d]pyrimidin-4-one (CAS 2738394-22-2) is a chemical compound with the molecular formula C8H5BrClN3O and a molecular weight of 274.50 g/mol. IUPAC name: 8-bromo-6-chloro-2-methyl-3H-pyrido[3,4-d]pyrimidin-4-one. InChIKey: PBLSXIFNLIERNQ-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClN3O |
|---|---|
| Molecular weight | 274.50 g/mol |
| IUPAC name | 8-bromo-6-chloro-2-methyl-3H-pyrido[3,4-d]pyrimidin-4-one |
| InChIKey | PBLSXIFNLIERNQ-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(N=C(C=C2C(=O)N1)Cl)Br |
Computed by PubChem (NCBI)