Products 1157776-47-0

CAS 1157776-47-0 is the registry number for 4-(4-Methanesulfonylphenoxy)butanoic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

4-(4-methylsulfonylphenoxy)butanoic acid (CAS 1157776-47-0) is a chemical compound with the molecular formula C11H14O5S and a molecular weight of 258.29 g/mol. IUPAC name: 4-(4-methylsulfonylphenoxy)butanoic acid. InChIKey: BDYYQKIEMMSADG-UHFFFAOYSA-N.

Identity
Molecular formulaC11H14O5S
Molecular weight258.29 g/mol
IUPAC name4-(4-methylsulfonylphenoxy)butanoic acid
InChIKeyBDYYQKIEMMSADG-UHFFFAOYSA-N
SMILESCS(=O)(=O)C1=CC=C(C=C1)OCCCC(=O)O

Computed by PubChem (NCBI)