Products 205504-66-1
CAS 205504-66-1 appears in our catalog under these names: 3-(4-Methoxybenzenesulfonyl)-2-methylpropanoic acid, 95%, 3-(4-Methoxybenzenesulfonyl)-2-methylpropanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
3-(4-methoxyphenyl)sulfonyl-2-methylpropanoic acid (CAS 205504-66-1) is a chemical compound with the molecular formula C11H14O5S and a molecular weight of 258.29 g/mol. IUPAC name: 3-(4-methoxyphenyl)sulfonyl-2-methylpropanoic acid. InChIKey: SMSUUKBWVCSLRN-UHFFFAOYSA-N.
| Molecular formula | C11H14O5S |
|---|---|
| Molecular weight | 258.29 g/mol |
| IUPAC name | 3-(4-methoxyphenyl)sulfonyl-2-methylpropanoic acid |
| InChIKey | SMSUUKBWVCSLRN-UHFFFAOYSA-N |
| SMILES | CC(CS(=O)(=O)C1=CC=C(C=C1)OC)C(=O)O |
Computed by PubChem (NCBI)