CAS 2305254-74-2 is the registry number for Ethyl 4-(ethoxysulfonyl)benzoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Ethyl 4-ethoxysulfonylbenzoate (CAS 2305254-74-2) is a chemical compound with the molecular formula C11H14O5S and a molecular weight of 258.29 g/mol. IUPAC name: ethyl 4-ethoxysulfonylbenzoate. InChIKey: WWJWYSLUTFZDIO-UHFFFAOYSA-N.
| Molecular formula | C11H14O5S |
|---|---|
| Molecular weight | 258.29 g/mol |
| IUPAC name | ethyl 4-ethoxysulfonylbenzoate |
| InChIKey | WWJWYSLUTFZDIO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)S(=O)(=O)OCC |
Computed by PubChem (NCBI)