Products 115787-53-6
CAS 115787-53-6 appears in our catalog under these names: Salbutamol Impurity S38901, Salbutamol Impurity 12. Offered by: Chemat Brand. Available pack sizes: on request.
5-[2-(tert-butylamino)acetyl]-2-hydroxybenzaldehyde;hydrochloride (CAS 115787-53-6) is a chemical compound with the molecular formula C13H18ClNO3 and a molecular weight of 271.74 g/mol. IUPAC name: 5-[2-(tert-butylamino)acetyl]-2-hydroxybenzaldehyde;hydrochloride. InChIKey: OEBULJXJRPCPIN-UHFFFAOYSA-N.
| Molecular formula | C13H18ClNO3 |
|---|---|
| Molecular weight | 271.74 g/mol |
| IUPAC name | 5-[2-(tert-butylamino)acetyl]-2-hydroxybenzaldehyde;hydrochloride |
| InChIKey | OEBULJXJRPCPIN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NCC(=O)C1=CC(=C(C=C1)O)C=O.Cl |
Computed by PubChem (NCBI)