CAS 1158261-16-5 appears in our catalog under these names: 2-Methyl-3,4-dihydro-2h-thieno[2,3-e][1,2]thiazin-4-amine 1,1-dioxide hydrochloride, 95%, 4-Amino-2-methyl-3,4-dihydro-2H-thieno[2,3-e][1,2]thiazine 1,1-dioxide hydrochloride, 98%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 250mg, 10g, 5g, 1g, on request.
2-methyl-1,1-dioxo-3,4-dihydrothieno[2,3-e]thiazin-4-amine;hydrochloride (CAS 1158261-16-5) is a chemical compound with the molecular formula C7H11ClN2O2S2 and a molecular weight of 254.8 g/mol. IUPAC name: 2-methyl-1,1-dioxo-3,4-dihydrothieno[2,3-e]thiazin-4-amine;hydrochloride. InChIKey: QNTGBORZPXJKKL-UHFFFAOYSA-N.
| Molecular formula | C7H11ClN2O2S2 |
|---|---|
| Molecular weight | 254.8 g/mol |
| IUPAC name | 2-methyl-1,1-dioxo-3,4-dihydrothieno[2,3-e]thiazin-4-amine;hydrochloride |
| InChIKey | QNTGBORZPXJKKL-UHFFFAOYSA-N |
| SMILES | CN1CC(C2=C(S1(=O)=O)C=CS2)N.Cl |
Computed by PubChem (NCBI)