CAS 2758004-27-0 is the registry number for 3-Amino-4-mercapto-N-methylbenzenesulfonamide hydrochloride. Offered by: Biosynth. Available pack sizes: 10mg, 5mg, 25mg, 50mg, 100mg.
3-amino-N-methyl-4-sulfanylbenzenesulfonamide;hydrochloride (CAS 2758004-27-0) is a chemical compound with the molecular formula C7H11ClN2O2S2 and a molecular weight of 254.8 g/mol. IUPAC name: 3-amino-N-methyl-4-sulfanylbenzenesulfonamide;hydrochloride. InChIKey: RWEDTQKOAJFWNB-UHFFFAOYSA-N.
| Molecular formula | C7H11ClN2O2S2 |
|---|---|
| Molecular weight | 254.8 g/mol |
| IUPAC name | 3-amino-N-methyl-4-sulfanylbenzenesulfonamide;hydrochloride |
| InChIKey | RWEDTQKOAJFWNB-UHFFFAOYSA-N |
| SMILES | CNS(=O)(=O)C1=CC(=C(C=C1)S)N.Cl |
Computed by PubChem (NCBI)