CAS 1989671-89-7 appears in our catalog under these names: 4H,5H,6H,7H-Thieno(3,2-c)pyridine-2-sulfonamide hydrochloride, 95%, 4H,5H,6H,7H-Thieno(3,2-c)pyridine-2-sulfonamide hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4,5,6,7-tetrahydrothieno[3,2-c]pyridine-2-sulfonamide;hydrochloride (CAS 1989671-89-7) is a chemical compound with the molecular formula C7H11ClN2O2S2 and a molecular weight of 254.8 g/mol. IUPAC name: 4,5,6,7-tetrahydrothieno[3,2-c]pyridine-2-sulfonamide;hydrochloride. InChIKey: RVJUEASNWDYXSN-UHFFFAOYSA-N.
| Molecular formula | C7H11ClN2O2S2 |
|---|---|
| Molecular weight | 254.8 g/mol |
| IUPAC name | 4,5,6,7-tetrahydrothieno[3,2-c]pyridine-2-sulfonamide;hydrochloride |
| InChIKey | RVJUEASNWDYXSN-UHFFFAOYSA-N |
| SMILES | C1CNCC2=C1SC(=C2)S(=O)(=O)N.Cl |
Computed by PubChem (NCBI)