CAS 115827-67-3 is the registry number for (Z)-tert-Butyldimethyl(penta-1,3-dien-3-yloxy)silane, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl-dimethyl-[(3Z)-penta-1,3-dien-3-yl]oxysilane (CAS 115827-67-3) is a chemical compound with the molecular formula C11H22OSi and a molecular weight of 198.38 g/mol. IUPAC name: tert-butyl-dimethyl-[(3Z)-penta-1,3-dien-3-yl]oxysilane. InChIKey: JKJNQXHPPKODQV-KTKRTIGZSA-N.
| Molecular formula | C11H22OSi |
|---|---|
| Molecular weight | 198.38 g/mol |
| IUPAC name | tert-butyl-dimethyl-[(3Z)-penta-1,3-dien-3-yl]oxysilane |
| InChIKey | JKJNQXHPPKODQV-KTKRTIGZSA-N |
| SMILES | C/C=C(/C=C)\O[Si](C)(C)C(C)(C)C |
Computed by PubChem (NCBI)