CAS 141081-41-6 appears in our catalog under these names: Tert-butyldimethyl(penta-3,4-dien-1-yloxy)silane, 98%, Tert-butyldimethyl(penta-3,4-dien-1-yloxy)silane, 98%, 98%. Offered by: Chemat Brand, Chemat, Fluorochem. Available pack sizes: on request, 100mg, 250mg.
Tert-butyl-dimethyl-penta-3,4-dienoxysilane (CAS 141081-41-6) is a chemical compound with the molecular formula C11H22OSi and a molecular weight of 198.38 g/mol. IUPAC name: tert-butyl-dimethyl-penta-3,4-dienoxysilane. InChIKey: NKTBGOLTVUDKMC-UHFFFAOYSA-N.
| Molecular formula | C11H22OSi |
|---|---|
| Molecular weight | 198.38 g/mol |
| IUPAC name | tert-butyl-dimethyl-penta-3,4-dienoxysilane |
| InChIKey | NKTBGOLTVUDKMC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCCC=C=C |
Computed by PubChem (NCBI)