CAS 80186-44-3 is the registry number for (1,1-Dimethylethyl)dimethyl((1-methyl-3-butynyl)oxy)silane. Offered by: TRC. Available pack sizes: 100mg, 250mg, 500mg.
Tert-butyl-dimethyl-pent-4-yn-2-yloxysilane (CAS 80186-44-3) is a chemical compound with the molecular formula C11H22OSi and a molecular weight of 198.38 g/mol. IUPAC name: tert-butyl-dimethyl-pent-4-yn-2-yloxysilane. InChIKey: YVRDZCNSSRJGLF-UHFFFAOYSA-N.
| Molecular formula | C11H22OSi |
|---|---|
| Molecular weight | 198.38 g/mol |
| IUPAC name | tert-butyl-dimethyl-pent-4-yn-2-yloxysilane |
| InChIKey | YVRDZCNSSRJGLF-UHFFFAOYSA-N |
| SMILES | CC(CC#C)O[Si](C)(C)C(C)(C)C |
Computed by PubChem (NCBI)