CAS 1158314-64-7 is the registry number for Ethyl (4-iodo-3,5-dimethyl-1h-pyrazol-1-yl)acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
Ethyl 2-(4-iodo-3,5-dimethylpyrazol-1-yl)acetate (CAS 1158314-64-7) is a chemical compound with the molecular formula C9H13IN2O2 and a molecular weight of 308.12 g/mol. IUPAC name: ethyl 2-(4-iodo-3,5-dimethylpyrazol-1-yl)acetate. InChIKey: SDHANGDZDQYQTG-UHFFFAOYSA-N.
| Molecular formula | C9H13IN2O2 |
|---|---|
| Molecular weight | 308.12 g/mol |
| IUPAC name | ethyl 2-(4-iodo-3,5-dimethylpyrazol-1-yl)acetate |
| InChIKey | SDHANGDZDQYQTG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CN1C(=C(C(=N1)C)I)C |
Computed by PubChem (NCBI)