CAS 2900374-33-4 is the registry number for 2-(4-Iodo-3,5-dimethyl-1H-pyrazol-1-yl)-2-methylpropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4-iodo-3,5-dimethylpyrazol-1-yl)-2-methylpropanoic acid (CAS 2900374-33-4) is a chemical compound with the molecular formula C9H13IN2O2 and a molecular weight of 308.12 g/mol. IUPAC name: 2-(4-iodo-3,5-dimethylpyrazol-1-yl)-2-methylpropanoic acid. InChIKey: ZGZHUQBWFPBNON-UHFFFAOYSA-N.
| Molecular formula | C9H13IN2O2 |
|---|---|
| Molecular weight | 308.12 g/mol |
| IUPAC name | 2-(4-iodo-3,5-dimethylpyrazol-1-yl)-2-methylpropanoic acid |
| InChIKey | ZGZHUQBWFPBNON-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C(C)(C)C(=O)O)C)I |
Computed by PubChem (NCBI)