Products 2900374-33-4

CAS 2900374-33-4 is the registry number for 2-(4-Iodo-3,5-dimethyl-1H-pyrazol-1-yl)-2-methylpropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-(4-iodo-3,5-dimethylpyrazol-1-yl)-2-methylpropanoic acid (CAS 2900374-33-4) is a chemical compound with the molecular formula C9H13IN2O2 and a molecular weight of 308.12 g/mol. IUPAC name: 2-(4-iodo-3,5-dimethylpyrazol-1-yl)-2-methylpropanoic acid. InChIKey: ZGZHUQBWFPBNON-UHFFFAOYSA-N.

Identity
Molecular formulaC9H13IN2O2
Molecular weight308.12 g/mol
IUPAC name2-(4-iodo-3,5-dimethylpyrazol-1-yl)-2-methylpropanoic acid
InChIKeyZGZHUQBWFPBNON-UHFFFAOYSA-N
SMILESCC1=C(C(=NN1C(C)(C)C(=O)O)C)I

Computed by PubChem (NCBI)