Products 1798775-86-6

CAS 1798775-86-6 is the registry number for 2-(4-Iodo-1-(2-methylpropyl)-1H-pyrazol-3-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-[4-iodo-1-(2-methylpropyl)pyrazol-3-yl]acetic acid (CAS 1798775-86-6) is a chemical compound with the molecular formula C9H13IN2O2 and a molecular weight of 308.12 g/mol. IUPAC name: 2-[4-iodo-1-(2-methylpropyl)pyrazol-3-yl]acetic acid. InChIKey: ISZMKMPSDQSJHF-UHFFFAOYSA-N.

Identity
Molecular formulaC9H13IN2O2
Molecular weight308.12 g/mol
IUPAC name2-[4-iodo-1-(2-methylpropyl)pyrazol-3-yl]acetic acid
InChIKeyISZMKMPSDQSJHF-UHFFFAOYSA-N
SMILESCC(C)CN1C=C(C(=N1)CC(=O)O)I

Computed by PubChem (NCBI)