Products 1158715-33-3
CAS 1158715-33-3 is the registry number for 5,7-Dichloro-2,3-dimethyl-1H-pyrrolo[2,3-c]pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5,7-dichloro-2,3-dimethyl-1H-pyrrolo[2,3-c]pyridine (CAS 1158715-33-3) is a chemical compound with the molecular formula C9H8Cl2N2 and a molecular weight of 215.08 g/mol. IUPAC name: 5,7-dichloro-2,3-dimethyl-1H-pyrrolo[2,3-c]pyridine. InChIKey: ZJWTWLFBRGXFSU-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2N2 |
|---|---|
| Molecular weight | 215.08 g/mol |
| IUPAC name | 5,7-dichloro-2,3-dimethyl-1H-pyrrolo[2,3-c]pyridine |
| InChIKey | ZJWTWLFBRGXFSU-UHFFFAOYSA-N |
| SMILES | CC1=C(NC2=C(N=C(C=C12)Cl)Cl)C |
Computed by PubChem (NCBI)