Products 503843-54-7
CAS 503843-54-7 appears in our catalog under these names: 2,6-Dichloro-4-isopropylnicotinonitrile, 95%, 2，6–Dichloro–4–isopropylnicotinonitrile, 2,6-Dichloro-4-isopropylnicotinonitrile 97%, 2,6-Dichloro-4-isopropylnicotinonitrile, 97%, 97%, 2,6-Dichloro-4-isopropylnicotinonitrile, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 100mg, 1g.
2,6-dichloro-4-propan-2-ylpyridine-3-carbonitrile (CAS 503843-54-7) is a chemical compound with the molecular formula C9H8Cl2N2 and a molecular weight of 215.08 g/mol. IUPAC name: 2,6-dichloro-4-propan-2-ylpyridine-3-carbonitrile. InChIKey: HVFVSBDQCMUTKF-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2N2 |
|---|---|
| Molecular weight | 215.08 g/mol |
| IUPAC name | 2,6-dichloro-4-propan-2-ylpyridine-3-carbonitrile |
| InChIKey | HVFVSBDQCMUTKF-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=NC(=C1C#N)Cl)Cl |
Computed by PubChem (NCBI)