CAS 2818-64-6 is the registry number for 5,6-Dichloro-1,2-dimethyl-1H-benzimidazole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
5,6-dichloro-1,2-dimethylbenzimidazole (CAS 2818-64-6) is a chemical compound with the molecular formula C9H8Cl2N2 and a molecular weight of 215.08 g/mol. IUPAC name: 5,6-dichloro-1,2-dimethylbenzimidazole. InChIKey: ZLJHHGSEAITOGJ-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2N2 |
|---|---|
| Molecular weight | 215.08 g/mol |
| IUPAC name | 5,6-dichloro-1,2-dimethylbenzimidazole |
| InChIKey | ZLJHHGSEAITOGJ-UHFFFAOYSA-N |
| SMILES | CC1=NC2=CC(=C(C=C2N1C)Cl)Cl |
Computed by PubChem (NCBI)