Products 1158743-29-3

CAS 1158743-29-3 is the registry number for 1-Methyl-n-(2-phenylethyl)-4-piperidinamine diethanedioate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 50g, 1g, 5g.

Structural formula: {0} (CAS {1})

1-methyl-N-(2-phenylethyl)piperidin-4-amine;oxalic acid (CAS 1158743-29-3) is a chemical compound with the molecular formula C18H26N2O8 and a molecular weight of 398.4 g/mol. IUPAC name: 1-methyl-N-(2-phenylethyl)piperidin-4-amine;oxalic acid. InChIKey: ZNTWSWMRQZQWTK-UHFFFAOYSA-N.

Identity
Molecular formulaC18H26N2O8
Molecular weight398.4 g/mol
IUPAC name1-methyl-N-(2-phenylethyl)piperidin-4-amine;oxalic acid
InChIKeyZNTWSWMRQZQWTK-UHFFFAOYSA-N
SMILESCN1CCC(CC1)NCCC2=CC=CC=C2.C(=O)(C(=O)O)O.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)