CAS 1158743-29-3 is the registry number for 1-Methyl-n-(2-phenylethyl)-4-piperidinamine diethanedioate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 50g, 1g, 5g.
1-methyl-N-(2-phenylethyl)piperidin-4-amine;oxalic acid (CAS 1158743-29-3) is a chemical compound with the molecular formula C18H26N2O8 and a molecular weight of 398.4 g/mol. IUPAC name: 1-methyl-N-(2-phenylethyl)piperidin-4-amine;oxalic acid. InChIKey: ZNTWSWMRQZQWTK-UHFFFAOYSA-N.
| Molecular formula | C18H26N2O8 |
|---|---|
| Molecular weight | 398.4 g/mol |
| IUPAC name | 1-methyl-N-(2-phenylethyl)piperidin-4-amine;oxalic acid |
| InChIKey | ZNTWSWMRQZQWTK-UHFFFAOYSA-N |
| SMILES | CN1CCC(CC1)NCCC2=CC=CC=C2.C(=O)(C(=O)O)O.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)