Products 773896-53-0
CAS 773896-53-0 is the registry number for N，N–bis–(tert–butoxycarbonyl)–2，5–bis–methoxycarbonyl–1，4–dihydropyrazine. Offered by: GLPBio. Available pack sizes: 200mg.
1-O,4-O-ditert-butyl 2-O,5-O-dimethyl pyrazine-1,2,4,5-tetracarboxylate (CAS 773896-53-0) is a chemical compound with the molecular formula C18H26N2O8 and a molecular weight of 398.4 g/mol. IUPAC name: 1-O,4-O-ditert-butyl 2-O,5-O-dimethyl pyrazine-1,2,4,5-tetracarboxylate. InChIKey: FSYAFTAGVDAPMN-UHFFFAOYSA-N.
| Molecular formula | C18H26N2O8 |
|---|---|
| Molecular weight | 398.4 g/mol |
| IUPAC name | 1-O,4-O-ditert-butyl 2-O,5-O-dimethyl pyrazine-1,2,4,5-tetracarboxylate |
| InChIKey | FSYAFTAGVDAPMN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(N(C=C1C(=O)OC)C(=O)OC(C)(C)C)C(=O)OC |
Computed by PubChem (NCBI)