CAS 1559062-09-7 is the registry number for [(1-Isopropyl-1,2,3,4-tetrahydro-6-quinolinyl)methyl]methylamine diethanedioate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
N-methyl-1-(1-propan-2-yl-3,4-dihydro-2H-quinolin-6-yl)methanamine;oxalic acid (CAS 1559062-09-7) is a chemical compound with the molecular formula C18H26N2O8 and a molecular weight of 398.4 g/mol. IUPAC name: N-methyl-1-(1-propan-2-yl-3,4-dihydro-2H-quinolin-6-yl)methanamine;oxalic acid. InChIKey: UMDPABRIQXMLHF-UHFFFAOYSA-N.
| Molecular formula | C18H26N2O8 |
|---|---|
| Molecular weight | 398.4 g/mol |
| IUPAC name | N-methyl-1-(1-propan-2-yl-3,4-dihydro-2H-quinolin-6-yl)methanamine;oxalic acid |
| InChIKey | UMDPABRIQXMLHF-UHFFFAOYSA-N |
| SMILES | CC(C)N1CCCC2=C1C=CC(=C2)CNC.C(=O)(C(=O)O)O.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)