CAS 1158744-53-6 is the registry number for 1-Boc-5-acetylindoline, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Tert-butyl 5-acetyl-2,3-dihydroindole-1-carboxylate (CAS 1158744-53-6) is a chemical compound with the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. IUPAC name: tert-butyl 5-acetyl-2,3-dihydroindole-1-carboxylate. InChIKey: QDMYBBNRQVHRKH-UHFFFAOYSA-N.
| Molecular formula | C15H19NO3 |
|---|---|
| Molecular weight | 261.32 g/mol |
| IUPAC name | tert-butyl 5-acetyl-2,3-dihydroindole-1-carboxylate |
| InChIKey | QDMYBBNRQVHRKH-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(C=C1)N(CC2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)