Products 1158770-65-0
CAS 1158770-65-0 is the registry number for (2-Furylmethyl)(2-pyridinylmethyl)amine oxalate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 50g, 1g, 5g.
N-(furan-2-ylmethyl)-1-pyridin-2-ylmethanamine;oxalic acid (CAS 1158770-65-0) is a chemical compound with the molecular formula C13H14N2O5 and a molecular weight of 278.26 g/mol. IUPAC name: N-(furan-2-ylmethyl)-1-pyridin-2-ylmethanamine;oxalic acid. InChIKey: WNBBDJVJTLFBBN-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O5 |
|---|---|
| Molecular weight | 278.26 g/mol |
| IUPAC name | N-(furan-2-ylmethyl)-1-pyridin-2-ylmethanamine;oxalic acid |
| InChIKey | WNBBDJVJTLFBBN-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)CNCC2=CC=CO2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)