CAS 1260857-16-6 appears in our catalog under these names: 4-(((4-(2-Hydroxyethyl)-1H-pyrrole-3-carbonyl)oxy)methyl)-1H-pyrrole-3-carboxylic acid, 95+%, Potassium Clavulanate EP Impurity F, Clavulanate Potassium Impurity 6（Clavulanate Potassium EP Impurity F）. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
4-[[4-(2-hydroxyethyl)-1H-pyrrole-3-carbonyl]oxymethyl]-1H-pyrrole-3-carboxylic acid (CAS 1260857-16-6) is a chemical compound with the molecular formula C13H14N2O5 and a molecular weight of 278.26 g/mol. IUPAC name: 4-[[4-(2-hydroxyethyl)-1H-pyrrole-3-carbonyl]oxymethyl]-1H-pyrrole-3-carboxylic acid. InChIKey: ACHZUSGZSRDYHQ-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O5 |
|---|---|
| Molecular weight | 278.26 g/mol |
| IUPAC name | 4-[[4-(2-hydroxyethyl)-1H-pyrrole-3-carbonyl]oxymethyl]-1H-pyrrole-3-carboxylic acid |
| InChIKey | ACHZUSGZSRDYHQ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN1)C(=O)OCC2=CNC=C2C(=O)O)CCO |
Computed by PubChem (NCBI)