CAS 1260897-42-4 is the registry number for N-Methyl-1-(3-phenyl-5-isoxazolyl)methanamine oxalate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
N-methyl-1-(3-phenyl-1,2-oxazol-5-yl)methanamine;oxalic acid (CAS 1260897-42-4) is a chemical compound with the molecular formula C13H14N2O5 and a molecular weight of 278.26 g/mol. IUPAC name: N-methyl-1-(3-phenyl-1,2-oxazol-5-yl)methanamine;oxalic acid. InChIKey: AJLXGVYNLHWXIZ-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O5 |
|---|---|
| Molecular weight | 278.26 g/mol |
| IUPAC name | N-methyl-1-(3-phenyl-1,2-oxazol-5-yl)methanamine;oxalic acid |
| InChIKey | AJLXGVYNLHWXIZ-UHFFFAOYSA-N |
| SMILES | CNCC1=CC(=NO1)C2=CC=CC=C2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)