CAS 115951-75-2 is the registry number for Methyl 7-methyl-1H-imidazo[4,5-b]pyridine-2-carboxylate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 7-methyl-1H-imidazo[4,5-b]pyridine-2-carboxylate (CAS 115951-75-2) is a chemical compound with the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. IUPAC name: methyl 7-methyl-1H-imidazo[4,5-b]pyridine-2-carboxylate. InChIKey: UAWTVMASMISYOW-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O2 |
|---|---|
| Molecular weight | 191.19 g/mol |
| IUPAC name | methyl 7-methyl-1H-imidazo[4,5-b]pyridine-2-carboxylate |
| InChIKey | UAWTVMASMISYOW-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=NC=C1)N=C(N2)C(=O)OC |
Computed by PubChem (NCBI)