CAS 1159511-15-5 is the registry number for 8-Hydroxymethylisoquinoline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 250mg, 5g, 100mg.
Isoquinolin-8-ylmethanol (CAS 1159511-15-5) is a chemical compound with the molecular formula C10H9NO and a molecular weight of 159.18 g/mol. IUPAC name: isoquinolin-8-ylmethanol. InChIKey: UDNDYRZGZAWJHB-UHFFFAOYSA-N.
| Molecular formula | C10H9NO |
|---|---|
| Molecular weight | 159.18 g/mol |
| IUPAC name | isoquinolin-8-ylmethanol |
| InChIKey | UDNDYRZGZAWJHB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=NC=C2)C(=C1)CO |
Computed by PubChem (NCBI)