Products 1159596-08-3

CAS 1159596-08-3 is the registry number for 5'-Cyano-[1,1':3',1''-terphenyl]-4,4''-dicarboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

4-[3-(4-carboxyphenyl)-5-cyanophenyl]benzoic acid (CAS 1159596-08-3) is a chemical compound with the molecular formula C21H13NO4 and a molecular weight of 343.3 g/mol. IUPAC name: 4-[3-(4-carboxyphenyl)-5-cyanophenyl]benzoic acid. InChIKey: FLLMXEFRUDKUCD-UHFFFAOYSA-N.

Identity
Molecular formulaC21H13NO4
Molecular weight343.3 g/mol
IUPAC name4-[3-(4-carboxyphenyl)-5-cyanophenyl]benzoic acid
InChIKeyFLLMXEFRUDKUCD-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C2=CC(=CC(=C2)C#N)C3=CC=C(C=C3)C(=O)O)C(=O)O

Computed by PubChem (NCBI)