Products 2459652-62-9
CAS 2459652-62-9 is the registry number for 5,5'-(Pyridine-3,5-diyl)diisophthalaldehyde, 98%, 98%. Offered by: Chemat. Available pack sizes: 250mg.
5-[5-(3,5-diformylphenyl)-3-pyridinyl]benzene-1,3-dicarbaldehyde (CAS 2459652-62-9) is a chemical compound with the molecular formula C21H13NO4 and a molecular weight of 343.3 g/mol. IUPAC name: 5-[5-(3,5-diformylphenyl)-3-pyridinyl]benzene-1,3-dicarbaldehyde. InChIKey: MUFDZZFALWSBFV-UHFFFAOYSA-N.
| Molecular formula | C21H13NO4 |
|---|---|
| Molecular weight | 343.3 g/mol |
| IUPAC name | 5-[5-(3,5-diformylphenyl)-3-pyridinyl]benzene-1,3-dicarbaldehyde |
| InChIKey | MUFDZZFALWSBFV-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C=O)C2=CC(=CN=C2)C3=CC(=CC(=C3)C=O)C=O)C=O |
Computed by PubChem (NCBI)