Products 19795-96-1

CAS 19795-96-1 is the registry number for 2-((9,10-Dioxo-9,10-dihydroanthracen-1-yl)amino)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[(9,10-dioxoanthracen-1-yl)amino]benzoic acid (CAS 19795-96-1) is a chemical compound with the molecular formula C21H13NO4 and a molecular weight of 343.3 g/mol. IUPAC name: 2-[(9,10-dioxoanthracen-1-yl)amino]benzoic acid. InChIKey: BXSCARJCEFJTJZ-UHFFFAOYSA-N.

Identity
Molecular formulaC21H13NO4
Molecular weight343.3 g/mol
IUPAC name2-[(9,10-dioxoanthracen-1-yl)amino]benzoic acid
InChIKeyBXSCARJCEFJTJZ-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(=O)C3=C(C2=O)C(=CC=C3)NC4=CC=CC=C4C(=O)O

Computed by PubChem (NCBI)