CAS 19795-96-1 is the registry number for 2-((9,10-Dioxo-9,10-dihydroanthracen-1-yl)amino)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(9,10-dioxoanthracen-1-yl)amino]benzoic acid (CAS 19795-96-1) is a chemical compound with the molecular formula C21H13NO4 and a molecular weight of 343.3 g/mol. IUPAC name: 2-[(9,10-dioxoanthracen-1-yl)amino]benzoic acid. InChIKey: BXSCARJCEFJTJZ-UHFFFAOYSA-N.
| Molecular formula | C21H13NO4 |
|---|---|
| Molecular weight | 343.3 g/mol |
| IUPAC name | 2-[(9,10-dioxoanthracen-1-yl)amino]benzoic acid |
| InChIKey | BXSCARJCEFJTJZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(C2=O)C(=CC=C3)NC4=CC=CC=C4C(=O)O |
Computed by PubChem (NCBI)