Products 204705-13-5
CAS 204705-13-5 is the registry number for 2,5-Dioxopyrrolidin-1-yl pyrene-1-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(2,5-dioxopyrrolidin-1-yl) pyrene-1-carboxylate (CAS 204705-13-5) is a chemical compound with the molecular formula C21H13NO4 and a molecular weight of 343.3 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) pyrene-1-carboxylate. InChIKey: IRZUVVROWPWZQL-UHFFFAOYSA-N.
| Molecular formula | C21H13NO4 |
|---|---|
| Molecular weight | 343.3 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) pyrene-1-carboxylate |
| InChIKey | IRZUVVROWPWZQL-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)C2=C3C=CC4=CC=CC5=C4C3=C(C=C5)C=C2 |
Computed by PubChem (NCBI)