Products 115973-80-3
CAS 115973-80-3 is the registry number for L-Idose-13C-2. Offered by: MedChemExpress. Available pack sizes: 1mg, 5mg.
(2R,3S,4R,5S)-2,3,4,5,6-pentahydroxy(613C)hexanal (CAS 115973-80-3) is a chemical compound with the molecular formula C6H12O6 and a molecular weight of 181.15 g/mol. IUPAC name: (2R,3S,4R,5S)-2,3,4,5,6-pentahydroxy(613C)hexanal. InChIKey: GZCGUPFRVQAUEE-DIGXEVASSA-N.
| Molecular formula | C6H12O6 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | (2R,3S,4R,5S)-2,3,4,5,6-pentahydroxy(613C)hexanal |
| InChIKey | GZCGUPFRVQAUEE-DIGXEVASSA-N |
| SMILES | [13CH2]([C@@H]([C@H]([C@@H]([C@H](C=O)O)O)O)O)O |
Computed by PubChem (NCBI)