CAS 1159822-98-6 is the registry number for 2-(4-Fluoro-1H-indol-3-yl)ethan-1-amine Hydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 0,5g, 50mg.
2-(4-fluoro-1H-indol-3-yl)ethanamine;hydrochloride (CAS 1159822-98-6) is a chemical compound with the molecular formula C10H12ClFN2 and a molecular weight of 214.67 g/mol. IUPAC name: 2-(4-fluoro-1H-indol-3-yl)ethanamine;hydrochloride. InChIKey: PLUPFHCRDIKLCL-UHFFFAOYSA-N.
| Molecular formula | C10H12ClFN2 |
|---|---|
| Molecular weight | 214.67 g/mol |
| IUPAC name | 2-(4-fluoro-1H-indol-3-yl)ethanamine;hydrochloride |
| InChIKey | PLUPFHCRDIKLCL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)F)C(=CN2)CCN.Cl |
Computed by PubChem (NCBI)