CAS 1248961-67-2 is the registry number for 1-(4-Chloro-2-fluorophenyl)pyrrolidin-3-amine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(4-chloro-2-fluorophenyl)pyrrolidin-3-amine (CAS 1248961-67-2) is a chemical compound with the molecular formula C10H12ClFN2 and a molecular weight of 214.67 g/mol. IUPAC name: 1-(4-chloro-2-fluorophenyl)pyrrolidin-3-amine. InChIKey: KCQYDDPNSIPFMZ-UHFFFAOYSA-N.
| Molecular formula | C10H12ClFN2 |
|---|---|
| Molecular weight | 214.67 g/mol |
| IUPAC name | 1-(4-chloro-2-fluorophenyl)pyrrolidin-3-amine |
| InChIKey | KCQYDDPNSIPFMZ-UHFFFAOYSA-N |
| SMILES | C1CN(CC1N)C2=C(C=C(C=C2)Cl)F |
Computed by PubChem (NCBI)