CAS 2711-58-2 is the registry number for 5-Fluorotryptamine. Offered by: ZABRONIONE. Available pack sizes: All package sizes.
2-(5-fluoro-1H-indol-3-yl)ethanamine;hydrochloride (CAS 2711-58-2) is a chemical compound with the molecular formula C10H12ClFN2 and a molecular weight of 214.67 g/mol. IUPAC name: 2-(5-fluoro-1H-indol-3-yl)ethanamine;hydrochloride. InChIKey: YZAWADGJXKCLTI-UHFFFAOYSA-N.
| Molecular formula | C10H12ClFN2 |
|---|---|
| Molecular weight | 214.67 g/mol |
| IUPAC name | 2-(5-fluoro-1H-indol-3-yl)ethanamine;hydrochloride |
| InChIKey | YZAWADGJXKCLTI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)C(=CN2)CCN.Cl |
Computed by PubChem (NCBI)