CAS 1159831-85-2 is the registry number for [1,2,4]Triazolo[3,4-a][2,7]naphthyridine-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[1,2,4]triazolo[3,4-a][2,7]naphthyridine-3-carboxylic acid (CAS 1159831-85-2) is a chemical compound with the molecular formula C10H6N4O2 and a molecular weight of 214.18 g/mol. IUPAC name: [1,2,4]triazolo[3,4-a][2,7]naphthyridine-3-carboxylic acid. InChIKey: WWNQIFMFLZSSFG-UHFFFAOYSA-N.
| Molecular formula | C10H6N4O2 |
|---|---|
| Molecular weight | 214.18 g/mol |
| IUPAC name | [1,2,4]triazolo[3,4-a][2,7]naphthyridine-3-carboxylic acid |
| InChIKey | WWNQIFMFLZSSFG-UHFFFAOYSA-N |
| SMILES | C1=CN=CC2=C1C=CN3C2=NN=C3C(=O)O |
Computed by PubChem (NCBI)