Products 1346602-14-9
CAS 1346602-14-9 is the registry number for 2-Nitrodipyrido(1,2-a:3',2’-d)imidazole. Offered by: TRC. Available pack sizes: 25mg.
4-nitro-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8,10,12-hexaene (CAS 1346602-14-9) is a chemical compound with the molecular formula C10H6N4O2 and a molecular weight of 214.18 g/mol. IUPAC name: 4-nitro-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8,10,12-hexaene. InChIKey: BDEGIVOKOYVTKE-UHFFFAOYSA-N.
| Molecular formula | C10H6N4O2 |
|---|---|
| Molecular weight | 214.18 g/mol |
| IUPAC name | 4-nitro-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8,10,12-hexaene |
| InChIKey | BDEGIVOKOYVTKE-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC3=C(N2C=C1)N=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)