CAS 59208-47-8 is the registry number for 2-(1H-1,2,4-Triazol-3-yl)-1h-isoindole-1,3(2h)-dione, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-(1H-1,2,4-triazol-5-yl)isoindole-1,3-dione (CAS 59208-47-8) is a chemical compound with the molecular formula C10H6N4O2 and a molecular weight of 214.18 g/mol. IUPAC name: 2-(1H-1,2,4-triazol-5-yl)isoindole-1,3-dione. InChIKey: HRTUZSIPQLUAJL-UHFFFAOYSA-N.
| Molecular formula | C10H6N4O2 |
|---|---|
| Molecular weight | 214.18 g/mol |
| IUPAC name | 2-(1H-1,2,4-triazol-5-yl)isoindole-1,3-dione |
| InChIKey | HRTUZSIPQLUAJL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)C3=NC=NN3 |
Computed by PubChem (NCBI)