CAS 1159944-09-8 appears in our catalog under these names: 4-[4-(N,N-Dimethylaminocarbonyl)phenyl]phenol, 98%, 4'-Hydroxy-N,N-dimethyl-(1,1'-biphenyl)-4-carboxamide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 5g, 1g.
4-(4-hydroxyphenyl)-N,N-dimethylbenzamide (CAS 1159944-09-8) is a chemical compound with the molecular formula C15H15NO2 and a molecular weight of 241.28 g/mol. IUPAC name: 4-(4-hydroxyphenyl)-N,N-dimethylbenzamide. InChIKey: KAVBJKJZODAIRN-UHFFFAOYSA-N.
| Molecular formula | C15H15NO2 |
|---|---|
| Molecular weight | 241.28 g/mol |
| IUPAC name | 4-(4-hydroxyphenyl)-N,N-dimethylbenzamide |
| InChIKey | KAVBJKJZODAIRN-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC=C(C=C1)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)