Products 1159976-75-6
CAS 1159976-75-6 is the registry number for 2,3-di(hydroxyimino)-5-phenylcyclohexan-1-one. Offered by: Biosynth. Available pack sizes: 250mg.
2,3-bis(hydroxyimino)-5-phenylcyclohexan-1-one (CAS 1159976-75-6) is a chemical compound with the molecular formula C12H12N2O3 and a molecular weight of 232.23 g/mol. IUPAC name: 2,3-bis(hydroxyimino)-5-phenylcyclohexan-1-one. InChIKey: UFWIQFLJKIESDI-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O3 |
|---|---|
| Molecular weight | 232.23 g/mol |
| IUPAC name | 2,3-bis(hydroxyimino)-5-phenylcyclohexan-1-one |
| InChIKey | UFWIQFLJKIESDI-UHFFFAOYSA-N |
| SMILES | C1C(CC(=O)C(=NO)C1=NO)C2=CC=CC=C2 |
Computed by PubChem (NCBI)