CAS 1159981-13-1 is the registry number for 4-(Bromomethyl)-3-(4-chlorophenyl)-5-methylisoxazole, 95%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 1g, 250mg.
4-(bromomethyl)-3-(4-chlorophenyl)-5-methyl-1,2-oxazole (CAS 1159981-13-1) is a chemical compound with the molecular formula C11H9BrClNO and a molecular weight of 286.55 g/mol. IUPAC name: 4-(bromomethyl)-3-(4-chlorophenyl)-5-methyl-1,2-oxazole. InChIKey: XNDFGMNICCDLGJ-UHFFFAOYSA-N.
| Molecular formula | C11H9BrClNO |
|---|---|
| Molecular weight | 286.55 g/mol |
| IUPAC name | 4-(bromomethyl)-3-(4-chlorophenyl)-5-methyl-1,2-oxazole |
| InChIKey | XNDFGMNICCDLGJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=CC=C(C=C2)Cl)CBr |
Computed by PubChem (NCBI)