CAS 2771024-20-3 is the registry number for 6'-Bromo-5'-chloro-2',3'-dihydro-1'H-spiro[cyclopropane-1,4'-isoquinolin]-1'-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-5-chlorospiro[2,3-dihydroisoquinoline-4,1'-cyclopropane]-1-one (CAS 2771024-20-3) is a chemical compound with the molecular formula C11H9BrClNO and a molecular weight of 286.55 g/mol. IUPAC name: 6-bromo-5-chlorospiro[2,3-dihydroisoquinoline-4,1'-cyclopropane]-1-one. InChIKey: MXIYHHXVVDIWLZ-UHFFFAOYSA-N.
| Molecular formula | C11H9BrClNO |
|---|---|
| Molecular weight | 286.55 g/mol |
| IUPAC name | 6-bromo-5-chlorospiro[2,3-dihydroisoquinoline-4,1'-cyclopropane]-1-one |
| InChIKey | MXIYHHXVVDIWLZ-UHFFFAOYSA-N |
| SMILES | C1CC12CNC(=O)C3=C2C(=C(C=C3)Br)Cl |
Computed by PubChem (NCBI)