CAS 1204810-86-5 appears in our catalog under these names: 3-Bromo-4-chloro-6-ethoxyquinoline, 95%, 3-Bromo-4-chloro-6-ethoxyquinoline, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
3-bromo-4-chloro-6-ethoxyquinoline (CAS 1204810-86-5) is a chemical compound with the molecular formula C11H9BrClNO and a molecular weight of 286.55 g/mol. IUPAC name: 3-bromo-4-chloro-6-ethoxyquinoline. InChIKey: HKIOCHWWMNQDEC-UHFFFAOYSA-N.
| Molecular formula | C11H9BrClNO |
|---|---|
| Molecular weight | 286.55 g/mol |
| IUPAC name | 3-bromo-4-chloro-6-ethoxyquinoline |
| InChIKey | HKIOCHWWMNQDEC-UHFFFAOYSA-N |
| SMILES | CCOC1=CC2=C(C(=CN=C2C=C1)Br)Cl |
Computed by PubChem (NCBI)