CAS 1159988-49-4 is the registry number for 3,5-Bis(3-methoxyphenyl)-1H-pyrazole. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3,5-bis(3-methoxyphenyl)-1H-pyrazole (CAS 1159988-49-4) is a chemical compound with the molecular formula C17H16N2O2 and a molecular weight of 280.32 g/mol. IUPAC name: 3,5-bis(3-methoxyphenyl)-1H-pyrazole. InChIKey: MCIHZKAEEMHEPO-UHFFFAOYSA-N.
| Molecular formula | C17H16N2O2 |
|---|---|
| Molecular weight | 280.32 g/mol |
| IUPAC name | 3,5-bis(3-methoxyphenyl)-1H-pyrazole |
| InChIKey | MCIHZKAEEMHEPO-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2=CC(=NN2)C3=CC(=CC=C3)OC |
Computed by PubChem (NCBI)