CAS 1160246-26-3 is the registry number for 2-{5-Methyl-2H-pyrazolo(3,4-b)pyridin-2-yl}acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(5-methylpyrazolo[3,4-b]pyridin-2-yl)acetic acid (CAS 1160246-26-3) is a chemical compound with the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. IUPAC name: 2-(5-methylpyrazolo[3,4-b]pyridin-2-yl)acetic acid. InChIKey: FGORNRHVYWLLJE-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O2 |
|---|---|
| Molecular weight | 191.19 g/mol |
| IUPAC name | 2-(5-methylpyrazolo[3,4-b]pyridin-2-yl)acetic acid |
| InChIKey | FGORNRHVYWLLJE-UHFFFAOYSA-N |
| SMILES | CC1=CC2=CN(N=C2N=C1)CC(=O)O |
Computed by PubChem (NCBI)