Products 1160246-26-3

CAS 1160246-26-3 is the registry number for 2-{5-Methyl-2H-pyrazolo(3,4-b)pyridin-2-yl}acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-(5-methylpyrazolo[3,4-b]pyridin-2-yl)acetic acid (CAS 1160246-26-3) is a chemical compound with the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. IUPAC name: 2-(5-methylpyrazolo[3,4-b]pyridin-2-yl)acetic acid. InChIKey: FGORNRHVYWLLJE-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9N3O2
Molecular weight191.19 g/mol
IUPAC name2-(5-methylpyrazolo[3,4-b]pyridin-2-yl)acetic acid
InChIKeyFGORNRHVYWLLJE-UHFFFAOYSA-N
SMILESCC1=CC2=CN(N=C2N=C1)CC(=O)O

Computed by PubChem (NCBI)