CAS 1160247-44-8 appears in our catalog under these names: tert-Butyl 6-methyl-3-oxo-2,3-dihydrospiro[indene-1,4'-piperidine]-1'-carboxylate, 95%, tert-Butyl 6-methyl-3-oxo-2,3-dihydrospiro(indene-1,4'-piperidine)-1'-carboxylate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
Tert-butyl 6-methyl-3-oxospiro[2H-indene-1,4'-piperidine]-1'-carboxylate (CAS 1160247-44-8) is a chemical compound with the molecular formula C19H25NO3 and a molecular weight of 315.4 g/mol. IUPAC name: tert-butyl 6-methyl-3-oxospiro[2H-indene-1,4'-piperidine]-1'-carboxylate. InChIKey: LRNHBSLYTKNFLA-UHFFFAOYSA-N.
| Molecular formula | C19H25NO3 |
|---|---|
| Molecular weight | 315.4 g/mol |
| IUPAC name | tert-butyl 6-methyl-3-oxospiro[2H-indene-1,4'-piperidine]-1'-carboxylate |
| InChIKey | LRNHBSLYTKNFLA-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C(=O)CC23CCN(CC3)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)