Products 1160247-61-9

CAS 1160247-61-9 is the registry number for tert-Butyl 6-methoxyspiro[indene-1,4'-piperidine]-1'-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

Tert-butyl 6-methoxyspiro[indene-1,4'-piperidine]-1'-carboxylate (CAS 1160247-61-9) is a chemical compound with the molecular formula C19H25NO3 and a molecular weight of 315.4 g/mol. IUPAC name: tert-butyl 6-methoxyspiro[indene-1,4'-piperidine]-1'-carboxylate. InChIKey: PFDCGHVOXGGTGC-UHFFFAOYSA-N.

Identity
Molecular formulaC19H25NO3
Molecular weight315.4 g/mol
IUPAC nametert-butyl 6-methoxyspiro[indene-1,4'-piperidine]-1'-carboxylate
InChIKeyPFDCGHVOXGGTGC-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC2(CC1)C=CC3=C2C=C(C=C3)OC

Computed by PubChem (NCBI)