CAS 22235-74-1 appears in our catalog under these names: (1R,5S)-8-isopropyl-8-azabicyclo(3.2.1)octan-3-yl 3-oxo-2-phenylpropanoate, Ipratropium Bromide Impurity 7. Offered by: Chemat Brand. Available pack sizes: on request.
[(1S,5R)-8-propan-2-yl-8-azabicyclo[3.2.1]octan-3-yl] 3-oxo-2-phenylpropanoate (CAS 22235-74-1) is a chemical compound with the molecular formula C19H25NO3 and a molecular weight of 315.4 g/mol. IUPAC name: [(1S,5R)-8-propan-2-yl-8-azabicyclo[3.2.1]octan-3-yl] 3-oxo-2-phenylpropanoate. InChIKey: OAGQQBLOOSHJLU-OQSMONGASA-N.
| Molecular formula | C19H25NO3 |
|---|---|
| Molecular weight | 315.4 g/mol |
| IUPAC name | [(1S,5R)-8-propan-2-yl-8-azabicyclo[3.2.1]octan-3-yl] 3-oxo-2-phenylpropanoate |
| InChIKey | OAGQQBLOOSHJLU-OQSMONGASA-N |
| SMILES | CC(C)N1[C@@H]2CC[C@H]1CC(C2)OC(=O)C(C=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)