Products 1160250-72-5

CAS 1160250-72-5 is the registry number for 2-Bromo-5-ethoxy-4-methoxybenzoyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-bromo-5-ethoxy-4-methoxybenzoyl chloride (CAS 1160250-72-5) is a chemical compound with the molecular formula C10H10BrClO3 and a molecular weight of 293.54 g/mol. IUPAC name: 2-bromo-5-ethoxy-4-methoxybenzoyl chloride. InChIKey: KEGBFVRCVUYMHR-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10BrClO3
Molecular weight293.54 g/mol
IUPAC name2-bromo-5-ethoxy-4-methoxybenzoyl chloride
InChIKeyKEGBFVRCVUYMHR-UHFFFAOYSA-N
SMILESCCOC1=C(C=C(C(=C1)C(=O)Cl)Br)OC

Computed by PubChem (NCBI)